| CAS: 82801-73-8 Product: Arg-Lys-Arg-Ala-Arg-Lys-Glu No suppliers available. |
| Name | Arg-Lys-Arg-Ala-Arg-Lys-Glu |
|---|---|
| Synonyms | (2S)-2-[[(2S)-6-amino-2-[[(2S)-2-[[(2S)-2-[[(2S)-2-[[(2S)-6-amino-2-[[(2S)-2-amino-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]propanoyl]amino]-5-(diaminomethylideneamino)pentanoyl]amino]hexanoyl]amino]pentanedioic acid |
| Molecular Structure | ![]() |
| Molecular Formula | C38H74N18O10 |
| Molecular Weight | 943.11 |
| Protein Sequence | RKRARKE |
| CAS Registry Number | 82801-73-8 |
| SMILES | C[C@@H](C(=O)N[C@@H](CCCN=C(N)N)C(=O)N[C@@H](CCCCN)C(=O)N[C@@H](CCC(=O)O)C(=O)O)NC(=O)[C@H](CCCN=C(N)N)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCN=C(N)N)N |
| Density | 1.5±0.1 g/cm3, Calc.* |
|---|---|
| Index of Refraction | 1.658, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Arg-Lys-Arg-Ala-Arg-Lys-Glu |