Online Database of Chemicals from Around the World
|
CAS#: 830-07-9 Product: Nitrofurilen No suppilers available for the product. |
| Name | Nitrofurilen |
|---|---|
| Synonyms | 2-Nitro-5-(2-Nitroethenyl)Furan; 2-Nitro-5-(2-Nitrovinyl)Furan; 2-Nitro-5-[(E)-2-Nitrovinyl]Furan |
| Molecular Structure |  |
| Molecular Formula | C6H4N2O5 |
| Molecular Weight | 184.11 |
| CAS Registry Number | 830-07-9 (32782-46-0) |
| SMILES | C1=C(OC(=C1)[N+]([O-])=O)\C=C\[N+]([O-])=O |
| InChI | 1S/C6H4N2O5/c9-7(10)4-3-5-1-2-6(13-5)8(11)12/h1-4H/b4-3+ |
| InChIKey | NMZDNQIJZAERIO-ONEGZZNKSA-N |
| Density | 1.518g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.908°C at 760 mmHg (Cal.) |
| Flash point | 147.275°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Nitrofurilen |