Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Biosynth AG. | Switzerland | Inquire | ||
|---|---|---|---|---|
|
+41 (71) 858-2020 | |||
|
welcome@biosynth.ch | |||
| Chemical manufacturer | ||||
| Name | DL-Indole-3-Lactic Acid |
|---|---|
| Synonyms | 2-Hydroxy-3-(1H-Indol-3-Yl)Propionic Acid; Dl-Indole-3-Lactic Acid; St055635 |
| Molecular Structure |  |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 |
| CAS Registry Number | 832-97-3 |
| EINECS | 212-627-9 |
| SMILES | C1=CC=CC2=C1C(=C[NH]2)CC(C(O)=O)O |
| InChI | 1S/C11H11NO3/c13-10(11(14)15)5-7-6-12-9-4-2-1-3-8(7)9/h1-4,6,10,12-13H,5H2,(H,14,15) |
| InChIKey | XGILAAMKEQUXLS-UHFFFAOYSA-N |
| Density | 1.428g/cm3 (Cal.) |
|---|---|
| Melting point | 145°C (Expl.) |
| Boiling point | 477.255°C at 760 mmHg (Cal.) |
| Flash point | 242.435°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for DL-Indole-3-Lactic Acid |