Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4,5-Difluorophthaloyl difluoride |
|---|---|
| Synonyms | 4,5-difluorophthaloyl difluoride |
| Molecular Structure |  |
| Molecular Formula | C8H2F4O2 |
| Molecular Weight | 206.09 |
| CAS Registry Number | 83684-75-7 |
| SMILES | Fc1cc(C(F)=O)c(cc1F)C(F)=O |
| InChI | 1S/C8H2F4O2/c9-5-1-3(7(11)13)4(8(12)14)2-6(5)10/h1-2H |
| InChIKey | ZVLWKPQDNWQZTH-UHFFFAOYSA-N |
| Density | 1.485g/cm3 (Cal.) |
|---|---|
| Boiling point | 250.007°C at 760 mmHg (Cal.) |
| Flash point | 95.13°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Difluorophthaloyl difluoride |