Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,2,3,8,9-Pentachlorodibenzofuran |
|---|---|
| Synonyms | Dibenzofuran, 1,2,3,8,9-Pentachloro-; Dibenzofuran, 1,2,3,8,9-Pentachloro |
| Molecular Structure |  |
| Molecular Formula | C12H3Cl5O |
| Molecular Weight | 340.42 |
| CAS Registry Number | 83704-54-5 |
| SMILES | C1=C(C(=C2C(=C1)OC3=C2C(=C(C(=C3)Cl)Cl)Cl)Cl)Cl |
| InChI | 1S/C12H3Cl5O/c13-4-1-2-6-8(10(4)15)9-7(18-6)3-5(14)11(16)12(9)17/h1-3H |
| InChIKey | NKGLWUJPCTUDEH-UHFFFAOYSA-N |
| Density | 1.7g/cm3 (Cal.) |
|---|---|
| Boiling point | 450.555°C at 760 mmHg (Cal.) |
| Flash point | 226.288°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,8,9-Pentachlorodibenzofuran |