Online Database of Chemicals from Around the World
|
CAS#: 70648-23-6 Product: 1,2,4,8,9-Pentachloro-Dibenzofuran No suppilers available for the product. |
| Name | 1,2,4,8,9-Pentachloro-Dibenzofuran |
|---|---|
| Synonyms | Dibenxofuran, 1,2,4,8,9-Pentachloro-; Dibenzofuran, 1,2,4,8,9-Pentachloro |
| Molecular Structure |  |
| Molecular Formula | C12H3Cl5O |
| Molecular Weight | 340.42 |
| CAS Registry Number | 70648-23-6 |
| SMILES | C1=C(C(=C2C(=C1)OC3=C2C(=C(C=C3Cl)Cl)Cl)Cl)Cl |
| InChI | 1S/C12H3Cl5O/c13-4-1-2-7-8(10(4)16)9-11(17)5(14)3-6(15)12(9)18-7/h1-3H |
| InChIKey | ZSPAPWGNAGTCCA-UHFFFAOYSA-N |
| Density | 1.7g/cm3 (Cal.) |
|---|---|
| Boiling point | 445.968°C at 760 mmHg (Cal.) |
| Flash point | 223.514°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,4,8,9-Pentachloro-Dibenzofuran |