Online Database of Chemicals from Around the World
|
CAS#: 83898-07-1 Product: 9-Octadecenylguanidine Monohydrochloride No suppilers available for the product. |
| Name | 9-Octadecenylguanidine Monohydrochloride |
|---|---|
| Synonyms | 9-Octadecenylguanidine Monohydrochloride |
| Molecular Structure |  |
| Molecular Formula | C19H40ClN3 |
| Molecular Weight | 346.00 |
| CAS Registry Number | 83898-07-1 |
| EINECS | 281-214-3 |
| SMILES | [H+].C(CCC\C=C\CCCCCCCC)CCCCN=C(N)N.[Cl-] |
| InChI | 1S/C19H39N3.ClH/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22-19(20)21;/h9-10H,2-8,11-18H2,1H3,(H4,20,21,22);1H/b10-9+; |
| InChIKey | ZWBBBGYIGHZAIS-RRABGKBLSA-N |
| Boiling point | 445.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 223.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-Octadecenylguanidine Monohydrochloride |