Online Database of Chemicals from Around the World
|
CAS#: 83929-68-4 Product: 2-(Allyloxy)-3,4,5,6-Tetrabromotoluene No suppilers available for the product. |
| Name | 2-(Allyloxy)-3,4,5,6-Tetrabromotoluene |
|---|---|
| Synonyms | 1-Allyloxy-2,3,4,5-Tetrabromo-6-Methyl-Benzene; 1-Allyloxy-2,3,4,5-Tetrabromo-6-Methylbenzene; 1,2,3,4-Tetrabromo-5-Methyl-6-Prop-2-Enoxy-Benzene |
| Molecular Structure |  |
| Molecular Formula | C10H8Br4O |
| Molecular Weight | 463.79 |
| CAS Registry Number | 83929-68-4 |
| EINECS | 281-361-3 |
| SMILES | C(OC1=C(C(=C(Br)C(=C1Br)Br)Br)C)C=C |
| InChI | 1S/C10H8Br4O/c1-3-4-15-10-5(2)6(11)7(12)8(13)9(10)14/h3H,1,4H2,2H3 |
| InChIKey | ATMWXSMLRHTKLA-UHFFFAOYSA-N |
| Density | 2.084g/cm3 (Cal.) |
|---|---|
| Boiling point | 400.796°C at 760 mmHg (Cal.) |
| Flash point | 165.217°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(Allyloxy)-3,4,5,6-Tetrabromotoluene |