|
CAS#: 26762-91-4 Product: (Allyloxy)Tribromobenzene No suppilers available for the product. |
| Name | (Allyloxy)Tribromobenzene |
|---|---|
| Synonyms | 1-Allyloxy-2,3,4-Tribromo-Benzene; 1-Allyloxy-2,3,4-Tribromobenzene; 1,2,3-Tribromo-4-Prop-2-Enoxy-Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C9H7Br3O |
| Molecular Weight | 370.87 |
| CAS Registry Number | 26762-91-4 |
| EINECS | 247-986-0 |
| SMILES | C1=CC(=C(Br)C(=C1Br)Br)OCC=C |
| InChI | 1S/C9H7Br3O/c1-2-5-13-7-4-3-6(10)8(11)9(7)12/h2-4H,1,5H2 |
| InChIKey | FJNNYLPBIOZVIQ-UHFFFAOYSA-N |
| Density | 1.951g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.233°C at 760 mmHg (Cal.) |
| Flash point | 142.759°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (Allyloxy)Tribromobenzene |