Online Database of Chemicals from Around the World
|
CAS#: 842-00-2 Product: 4-Ethylsulfonylnaphthanele-1-Sulfonamide No suppilers available for the product. |
| Name | 4-Ethylsulfonylnaphthanele-1-Sulfonamide |
|---|---|
| Synonyms | 4-Ethylsulfonyl-1-Naphthalenesulfonamide; 1-Naphthalenesulfonamide, 4-(Ethylsulfonyl)-; 4-(Ethylsulfonyl)-1-Naphthalenesulfonamide |
| Molecular Structure |  |
| Molecular Formula | C12H13NO4S2 |
| Molecular Weight | 299.36 |
| CAS Registry Number | 842-00-2 |
| SMILES | C1=C(C2=C(C(=C1)[S](CC)(=O)=O)C=CC=C2)[S](N)(=O)=O |
| InChI | 1S/C12H13NO4S2/c1-2-18(14,15)11-7-8-12(19(13,16)17)10-6-4-3-5-9(10)11/h3-8H,2H2,1H3,(H2,13,16,17) |
| InChIKey | BLQOLXMZXQXGOL-UHFFFAOYSA-N |
| Density | 1.42g/cm3 (Cal.) |
|---|---|
| Boiling point | 571.589°C at 760 mmHg (Cal.) |
| Flash point | 299.487°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Ethylsulfonylnaphthanele-1-Sulfonamide |