Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 | www.bocsci.com | |||
 | +1 (631) 485-4226 | |||
 | +1 (631) 614-7828 | |||
 | info@bocsci.com | |||
| Chemical manufacturer | ||||
| chemBlink Standard supplier since 2010 | ||||
| Name | Etomidate Impurity 1 |
|---|---|
| Synonyms | 1-[(1R)-1-Phenylethyl]-1H-imidazole |
| Molecular Structure |  |
| Molecular Formula | C11H12N2 |
| Molecular Weight | 172.23 |
| CAS Registry Number | 844658-92-0 |
| SMILES | C[C@H](C1=CC=CC=C1)N2C=CN=C2 |
| Solubility | 279.1 mg/L (25 °C water) |
|---|---|
| Density | 1.0±0.1 g/cm3, Calc.* |
| Index of Refraction | 1.571, Calc.* |
| Melting point | 85.09 °C |
| Boiling Point | 322.16 °C, 307.6±11.0 °C (760 mmHg), Calc.* |
| Flash Point | 139.9±19.3 °C, Calc.* |
| * | Calculated using Advanced Chemistry Development (ACD/Labs) Software. |
| Market Analysis Reports |
| List of Reports Available for Etomidate Impurity 1 |