Online Database of Chemicals from Around the World
|
CAS#: 84540-48-7 Product: (2,4-Diaminophenoxy)Acetic Acid No suppilers available for the product. |
| Name | (2,4-Diaminophenoxy)Acetic Acid |
|---|---|
| Synonyms | 2-(2,4-Diaminophenoxy)Ethanoic Acid; (2,4-Diaminophenoxy)Acetic Acid |
| Molecular Structure |  |
| Molecular Formula | C8H10N2O3 |
| Molecular Weight | 182.18 |
| CAS Registry Number | 84540-48-7 |
| EINECS | 283-142-8 |
| SMILES | C1=CC(=CC(=C1OCC(=O)O)N)N |
| InChI | 1S/C8H10N2O3/c9-5-1-2-7(6(10)3-5)13-4-8(11)12/h1-3H,4,9-10H2,(H,11,12) |
| InChIKey | UEANEAODIZOETQ-UHFFFAOYSA-N |
| Density | 1.411g/cm3 (Cal.) |
|---|---|
| Boiling point | 440.919°C at 760 mmHg (Cal.) |
| Flash point | 220.46°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,4-Diaminophenoxy)Acetic Acid |