Online Database of Chemicals from Around the World
|
CAS#: 84753-07-1 Product: Vinyl 4-Chlorobenzenesulphonate No suppilers available for the product. |
| Name | Vinyl 4-Chlorobenzenesulphonate |
|---|---|
| Synonyms | Vinyl 4-Chlorobenzenesulfonate; 4-Chlorobenzenesulfonic Acid Vinyl Ester |
| Molecular Structure |  |
| Molecular Formula | C8H7ClO3S |
| Molecular Weight | 218.65 |
| CAS Registry Number | 84753-07-1 |
| EINECS | 283-853-3 |
| SMILES | C1=C(Cl)C=CC(=C1)[S](OC=C)(=O)=O |
| InChI | 1S/C8H7ClO3S/c1-2-12-13(10,11)8-5-3-7(9)4-6-8/h2-6H,1H2 |
| InChIKey | AOLDJEQPBSWTNK-UHFFFAOYSA-N |
| Density | 1.357g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.17°C at 760 mmHg (Cal.) |
| Flash point | 151.667°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Vinyl 4-Chlorobenzenesulphonate |