Online Database of Chemicals from Around the World
|
CAS#: 84761-80-8 Product: 1,2,7,8-Tetrabromodibenzofuran No suppilers available for the product. |
| Name | 1,2,7,8-Tetrabromodibenzofuran |
|---|---|
| Synonyms | 1,2,7,8-Tbdf; Dibenzofuran, 1,2,7,8-Tetrabromo-; 1,2,7,8-Tetrabromo-Dibenzofuran |
| Molecular Structure |  |
| Molecular Formula | C12H4Br4O |
| Molecular Weight | 483.78 |
| CAS Registry Number | 84761-80-8 |
| SMILES | C1=C3C(=C(C(=C1)Br)Br)C2=CC(=C(C=C2O3)Br)Br |
| InChI | 1S/C12H4Br4O/c13-6-1-2-9-11(12(6)16)5-3-7(14)8(15)4-10(5)17-9/h1-4H |
| InChIKey | CUYJKQXKKDTMCW-UHFFFAOYSA-N |
| Density | 2.358g/cm3 (Cal.) |
|---|---|
| Boiling point | 495.926°C at 760 mmHg (Cal.) |
| Flash point | 253.727°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,7,8-Tetrabromodibenzofuran |