| Zhengzhou Kingorgchem Chemical Technology Co., Ltd. | China | |||
|---|---|---|---|---|
![]() | www.kingorgchem.com | |||
![]() | +86 (371) 6551-1006 | |||
![]() | +86 (371) 6575-6965 | |||
![]() | sales@kingorgchem.com | |||
![]() | QQ Chat | |||
![]() | WeChat: 18625597674 | |||
| Chemical manufacturer since 2015 | ||||
| chemBlink Standard supplier since 2016 | ||||
| Classification | Chemical reagent >> Organic reagent >> Phosphine ligand |
|---|---|
| Name | Iron(2+) 1-[(1R)-1-{bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl}ethyl]-2-[2-(dicyclohexylphosphanyl)phenyl]cyclopenta-2,4-dien-1-ide cyclopenta-2,4-dien-1-ide (1/1/1) |
| Synonyms | Bis[3,5-bis(trifluoromethyl)phenyl]-[(1R)-1-[5-(2-dicyclohexylphosphanylphenyl)cyclopenta-1,3-dien-1-yl]ethyl]phosphane cyclopenta-1,3-diene iron(2+) |
| Molecular Structure | ![]() |
| Molecular Formula | C46H44F12FeP2 |
| Molecular Weight | 942.61 |
| CAS Registry Number | 849925-22-0 |
| SMILES | C[C@H](C1=CC=C[C-]1C2=CC=CC=C2P(C3CCCCC3)C4CCCCC4)P(C5=CC(=CC(=C5)C(F)(F)F)C(F)(F)F)C6=CC(=CC(=C6)C(F)(F)F)C(F)(F)F.[CH-]1C=CC=C1.[Fe+2] |
| Hazard Symbols | |
|---|---|
| Risk Statements | H302-H315-H319-H335 Details |
| Safety Statements | P261-P305+P351+P338 Details |
| SDS | Available |
|
Iron(2+) 1-[(1R)-1-{bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl}ethyl]-2-[2-(dicyclohexylphosphanyl)phenyl]cyclopenta-2,4-dien-1-ide cyclopenta-2,4-dien-1-ide (1/1/1) is a sophisticated organometallic complex with unique chemical properties and applications. This compound integrates iron with an intricate phosphine ligand system, showcasing advancements in the design of transition metal complexes. The discovery of this compound reflects a broader effort to develop more effective catalysts for various chemical reactions. The ligand framework consists of bulky phosphine groups attached to an iron center, which is coordinated by a cyclopenta-2,4-dien-1-ide unit. This structure is designed to enhance the stability and reactivity of the iron center, making it suitable for catalysis. One of the primary applications of this iron complex is in catalysis, particularly in reactions that require the manipulation of carbon-carbon and carbon-heteroatom bonds. The bulky phosphine ligands provide electronic and steric effects that can significantly influence the reactivity of the iron center. This can lead to more efficient and selective catalysis in various chemical transformations. For instance, the iron complex has shown promise in catalyzing olefin polymerization and other polymerization processes. The unique ligand environment around the iron center can help control the polymerization process, leading to polymers with desirable properties. This capability is particularly valuable in materials science, where precise control over polymer structure can result in advanced materials with tailored characteristics. In addition to polymerization, the iron complex can be used in cross-coupling reactions, which are fundamental for the synthesis of complex organic molecules. The stability and reactivity of the iron center, enhanced by the phosphine ligands, make it a suitable candidate for these reactions, offering a cost-effective alternative to more expensive metal catalysts. The development of this iron complex underscores the importance of ligand design in transition metal chemistry. By incorporating bulky and electron-donating phosphine groups, researchers have created a system that enhances the performance of iron in catalysis. This approach opens new avenues for the application of iron complexes in chemical synthesis and industrial processes. In summary, Iron(2+) 1-[(1R)-1-{bis[3,5-bis(trifluoromethyl)phenyl]phosphanyl}ethyl]-2-[2-(dicyclohexylphosphanyl)phenyl]cyclopenta-2,4-dien-1-ide cyclopenta-2,4-dien-1-ide (1/1/1) represents a significant advancement in organometallic chemistry. Its unique ligand system and versatile applications in catalysis highlight the ongoing innovation in the design of metal complexes for various chemical processes. |
| Market Analysis Reports |