|
CAS#: 93981-08-9 Product: Iron(2+) bis(2-ethylhexanoate) No suppilers available for the product. |
| Name | Iron(2+) bis(2-ethylhexanoate) |
|---|---|
| Synonyms | 2-ethylhexanoic acid, iron salt; Iron 2-ethylhexanoate; iron bis(2-ethylhexanoate) |
| Molecular Structure | ![]() |
| Molecular Formula | C16H30FeO4 |
| Molecular Weight | 342.25 |
| CAS Registry Number | 93981-08-9 |
| EINECS | 301-090-7 |
| SMILES | [Fe+2].[O-]C(=O)C(CC)CCCC.[O-]C(=O)C(CC)CCCC |
| InChI | 1S/2C8H16O2.Fe/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-2 |
| InChIKey | SMSVUYQRWYTTLI-UHFFFAOYSA-L |
| Boiling point | 228°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 116.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Iron(2+) bis(2-ethylhexanoate) |