Online Database of Chemicals from Around the World
|
CAS#: 85049-96-3 Product: 3-(m-Toluidino)Phenol No suppilers available for the product. |
| Name | 3-(m-Toluidino)Phenol |
|---|---|
| Synonyms | M-(M-Toluidino)Phenol |
| Molecular Structure |  |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 |
| CAS Registry Number | 85049-96-3 |
| EINECS | 285-269-4 |
| SMILES | C1=C(O)C=CC=C1NC2=CC(=CC=C2)C |
| InChI | 1S/C13H13NO/c1-10-4-2-5-11(8-10)14-12-6-3-7-13(15)9-12/h2-9,14-15H,1H3 |
| InChIKey | NNOAVNCSVAGCLY-UHFFFAOYSA-N |
| Density | 1.171g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.631°C at 760 mmHg (Cal.) |
| Flash point | 142.842°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(m-Toluidino)Phenol |