Online Database of Chemicals from Around the World
|
CAS#: 94-57-5 Product: o-Toluidinomethanesulphonic acid No suppilers available for the product. |
| Name | o-Toluidinomethanesulphonic acid |
|---|---|
| Synonyms | Nsc 11212; O-Toluidinomethanesulphonic Acid |
| Molecular Structure |  |
| Molecular Formula | C8H11NO3S |
| Molecular Weight | 201.24 |
| CAS Registry Number | 94-57-5 |
| EINECS | 202-343-3 |
| SMILES | C1=CC=CC(=C1NC[S](=O)(=O)O)C |
| InChI | 1S/C8H11NO3S/c1-7-4-2-3-5-8(7)9-6-13(10,11)12/h2-5,9H,6H2,1H3,(H,10,11,12) |
| InChIKey | HFFSVWNRHLTGLV-UHFFFAOYSA-N |
| Density | 1.4g/cm3 (Cal.) |
|---|---|
| Market Analysis Reports |
| List of Reports Available for o-Toluidinomethanesulphonic acid |