Online Database of Chemicals from Around the World
|
CAS#: 85204-37-1 Product: Potassium sodium 2,2'-methylenebis(3,4,6-trichlorophenolate) (1:1:1) No suppilers available for the product. |
| Name | Potassium sodium 2,2'-methylenebis(3,4,6-trichlorophenolate) (1:1:1) |
|---|---|
| Synonyms | potassium sodium 2,2'-methylenebis[3,4,6-trichlorophenolate] |
| Molecular Structure |  |
| Molecular Formula | C13H4Cl6KNaO2 |
| Molecular Weight | 466.98 |
| CAS Registry Number | 85204-37-1 |
| EINECS | 286-333-4 |
| SMILES | [K+].[Na+].Clc2c(Cc1c([O-])c(Cl)cc(Cl)c1Cl)c([O-])c(Cl)cc2Cl |
| InChI | 1S/C13H6Cl6O2.K.Na/c14-6-2-8(16)12(20)4(10(6)18)1-5-11(19)7(15)3-9(17)13(5)21;;/h2-3,20-21H,1H2;;/q;2*+1/p-2 |
| InChIKey | XVLKPLNXFKHPPI-UHFFFAOYSA-L |
| Market Analysis Reports |
| List of Reports Available for Potassium sodium 2,2'-methylenebis(3,4,6-trichlorophenolate) (1:1:1) |