Online Database of Chemicals from Around the World
|
CAS#: 85896-28-2 Product: 2,4-Bis(allyloxy)-6-(4-nonylphenoxy)-1,3,5-triazine No suppilers available for the product. |
| Name | 2,4-Bis(allyloxy)-6-(4-nonylphenoxy)-1,3,5-triazine |
|---|---|
| Synonyms | 4,6-di(allyloxy)-2-(4-nonylphenoxy)-1,3,5-triazine |
| Molecular Structure |  |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.54 |
| CAS Registry Number | 85896-28-2 |
| EINECS | 288-805-5 |
| SMILES | O(c1nc(nc(OC\C=C)n1)Oc2ccc(cc2)CCCCCCCCC)C/C=C |
| InChI | 1S/C24H33N3O3/c1-4-7-8-9-10-11-12-13-20-14-16-21(17-15-20)30-24-26-22(28-18-5-2)25-23(27-24)29-19-6-3/h5-6,14-17H,2-4,7-13,18-19H2,1H3 |
| InChIKey | MDHFWELCWRCKNY-UHFFFAOYSA-N |
| Density | 1.049g/cm3 (Cal.) |
|---|---|
| Boiling point | 530.303°C at 760 mmHg (Cal.) |
| Flash point | 186.903°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Bis(allyloxy)-6-(4-nonylphenoxy)-1,3,5-triazine |