| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Tocris Bioscience Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (636) 207-7651 | |||
![]() |
marketing@tocrisusa.com | |||
| Chemical manufacturer since 1982 | ||||
| Name | N,N-Bis(allyl)-tyrosyl-glycyl-glycyl-psi-methylthio-phenylalanyl-leucine |
|---|---|
| Synonyms | (2S)-2-[[(2S)-2-[2-[[2-[[(2S)-2-(Diallylamino)-3-(4-Hydroxyphenyl)Propanoyl]Amino]Acetyl]Amino]Ethylsulfanyl]-3-Phenyl-Propanoyl]Amino]-4-Methyl-Pentanoic Acid; (2S)-2-[[(2S)-2-[2-[[2-[[(2S)-2-(Diallylamino)-3-(4-Hydroxyphenyl)-1-Oxopropyl]Amino]-1-Oxoethyl]Amino]Ethylthio]-1-Oxo-3-Phenylpropyl]Amino]-4-Methylpentanoic Acid; (2S)-2-[[(2S)-2-[2-[[2-[[(2S)-2-(Diallylamino)-3-(4-Hydroxyphenyl)Propanoyl]Amino]Acetyl]Amino]Ethylthio]-3-Phenyl-Propanoyl]Amino]-4-Methyl-Valeric Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C34H46N4O6S |
| Molecular Weight | 638.82 |
| CAS Registry Number | 83420-94-4 |
| SMILES | [C@@H](N(CC=C)CC=C)(C(=O)NCC(=O)NCCS[C@H](C(=O)N[C@H](C(=O)O)CC(C)C)CC1=CC=CC=C1)CC2=CC=C(O)C=C2 |
| InChI | 1S/C34H46N4O6S/c1-5-17-38(18-6-2)29(21-26-12-14-27(39)15-13-26)32(41)36-23-31(40)35-16-19-45-30(22-25-10-8-7-9-11-25)33(42)37-28(34(43)44)20-24(3)4/h5-15,24,28-30,39H,1-2,16-23H2,3-4H3,(H,35,40)(H,36,41)(H,37,42)(H,43,44)/t28-,29-,30-/m0/s1 |
| InChIKey | CZRZYRKTYLLLRL-DTXPUJKBSA-N |
| Density | 1.19g/cm3 (Cal.) |
|---|---|
| Boiling point | 929.425°C at 760 mmHg (Cal.) |
| Flash point | 515.898°C (Cal.) |
| solubility | Soluble to 1 mg/ml in methanol |
| Market Analysis Reports |
| List of Reports Available for N,N-Bis(allyl)-tyrosyl-glycyl-glycyl-psi-methylthio-phenylalanyl-leucine |