Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | Ethyl 1-(chlorocarbonyl)-L-prolinate |
|---|---|
| Synonyms | (S)-ethyl 1-(chlorocarbonyl)pyrrolidine-2-carboxylate |
| Molecular Structure |  |
| Molecular Formula | C8H12ClNO3 |
| Molecular Weight | 205.64 |
| CAS Registry Number | 86050-92-2 |
| SMILES | CCOC(=O)[C@@H]1CCCN1C(=O)Cl |
| InChI | 1S/C8H12ClNO3/c1-2-13-7(11)6-4-3-5-10(6)8(9)12/h6H,2-5H2,1H3/t6-/m0/s1 |
| InChIKey | GXGIAWVNSILRTK-LURJTMIESA-N |
| Density | 1.285g/cm3 (Cal.) |
|---|---|
| Boiling point | 301.822°C at 760 mmHg (Cal.) |
| Flash point | 136.337°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 1-(chlorocarbonyl)-L-prolinate |