Online Database of Chemicals from Around the World
|
CAS#: 93951-16-7 Product: Ethyl 3-(Chlorocarbonyl)-5-Nitrobenzoate No suppilers available for the product. |
| Name | Ethyl 3-(Chlorocarbonyl)-5-Nitrobenzoate |
|---|---|
| Synonyms | Ethyl 3-Chlorocarbonyl-5-Nitro-Benzoate; 3-Chlorocarbonyl-5-Nitrobenzoic Acid Ethyl Ester; 3-Chlorocarbonyl-5-Nitro-Benzoic Acid Ethyl Ester |
| Molecular Structure |  |
| Molecular Formula | C10H8ClNO5 |
| Molecular Weight | 257.63 |
| CAS Registry Number | 93951-16-7 |
| EINECS | 300-638-2 |
| SMILES | C1=C(C(Cl)=O)C=C(C(OCC)=O)C=C1[N+]([O-])=O |
| InChI | 1S/C10H8ClNO5/c1-2-17-10(14)7-3-6(9(11)13)4-8(5-7)12(15)16/h3-5H,2H2,1H3 |
| InChIKey | ILPBPWRYTWVDGD-UHFFFAOYSA-N |
| Density | 1.415g/cm3 (Cal.) |
|---|---|
| Boiling point | 380.279°C at 760 mmHg (Cal.) |
| Flash point | 183.787°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 3-(Chlorocarbonyl)-5-Nitrobenzoate |