|
CAS#: 86098-92-2 Product: 4-[Bis(2-chloroethyl)amino]phenyl thiocyanate No suppilers available for the product. |
| Name | 4-[Bis(2-chloroethyl)amino]phenyl thiocyanate |
|---|---|
| Synonyms | 4-[bis(2-chloroethyl)amino]phenyl thiocyanate; NSC63023 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H12Cl2N2S |
| Molecular Weight | 275.20 |
| CAS Registry Number | 86098-92-2 |
| SMILES | N#CSc1ccc(cc1)N(CCCl)CCCl |
| InChI | 1S/C11H12Cl2N2S/c12-5-7-15(8-6-13)10-1-3-11(4-2-10)16-9-14/h1-4H,5-8H2 |
| InChIKey | XTOTUADJOUZGGV-UHFFFAOYSA-N |
| Density | 1.315g/cm3 (Cal.) |
|---|---|
| Boiling point | 415.322°C at 760 mmHg (Cal.) |
| Flash point | 204.979°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[Bis(2-chloroethyl)amino]phenyl thiocyanate |