|
CAS#: 864754-15-4 Product: 4,4,5,5-Tetramethyl-2-[3-(2,2,2-Trifluoro-Ethoxy)-Phenyl]-[1,3,2]Dioxaborolane No suppilers available for the product. |
| Name | 4,4,5,5-Tetramethyl-2-[3-(2,2,2-Trifluoro-Ethoxy)-Phenyl]-[1,3,2]Dioxaborolane |
|---|---|
| Synonyms | Fs000533 |
| Molecular Structure | ![]() |
| Molecular Formula | C14H18BF3O3 |
| Molecular Weight | 302.10 |
| CAS Registry Number | 864754-15-4 |
| SMILES | C1=C(OCC(F)(F)F)C=CC=C1B2OC(C(O2)(C)C)(C)C |
| InChI | 1S/C14H18BF3O3/c1-12(2)13(3,4)21-15(20-12)10-6-5-7-11(8-10)19-9-14(16,17)18/h5-8H,9H2,1-4H3 |
| InChIKey | PYNYSUPBDKBNOM-UHFFFAOYSA-N |
| Density | 1.165g/cm3 (Cal.) |
|---|---|
| Boiling point | 332.971°C at 760 mmHg (Cal.) |
| Flash point | 155.176°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,4,5,5-Tetramethyl-2-[3-(2,2,2-Trifluoro-Ethoxy)-Phenyl]-[1,3,2]Dioxaborolane |