| SL Drugs and Pharmaceuticals Pvt. Ltd. | India | Inquire | ||
|---|---|---|---|---|
![]() |
+91 (40) 6661-1133 | |||
![]() |
enquiry@sldrugs.com | |||
| Chemical distributor since 1999 | ||||
| Tyger Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (609) 434-0144 | |||
![]() |
sales@tygersci.com | |||
| Chemical manufacturer since 1992 | ||||
| Name | Methyl 2,3-dimethyl-9-oxo-5,6,7,9-tetrahydrofuro[2,3-f]indolizine-4-carboxylate |
|---|---|
| Synonyms | methyl 2, |
| Molecular Structure | ![]() |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.27 |
| CAS Registry Number | 866393-56-8 |
| SMILES | O=C(OC)C=2c1c(oc(c1C)C)C(=O)N3C=2CCC3 |
| InChI | 1S/C14H15NO4/c1-7-8(2)19-12-10(7)11(14(17)18-3)9-5-4-6-15(9)13(12)16/h4-6H2,1-3H3 |
| InChIKey | WEZXGBMWZWQTKD-UHFFFAOYSA-N |
| Density | 1.324g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.413°C at 760 mmHg (Cal.) |
| Flash point | 229.83°C (Cal.) |
| Refractive index | 1.592 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl 2,3-dimethyl-9-oxo-5,6,7,9-tetrahydrofuro[2,3-f]indolizine-4-carboxylate |