Online Database of Chemicals from Around the World
| Trylead Chemical Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (571) 8708-6220 | |||
 |
info@trylead-chem.com | |||
| Chemical manufacturer since 2006 | ||||
| Name | 2-(1H-Inden-6-yl)-1,3-thiazole |
|---|---|
| Synonyms | 2-(1H-inden-6-yl)thiazole; Thiazole, 2-(1H-inden-6-yl)-; TL8005644 |
| Molecular Structure |  |
| Molecular Formula | C12H9NS |
| Molecular Weight | 199.27 |
| CAS Registry Number | 869725-79-1 |
| SMILES | C1\C=C/c2ccc(cc12)c3nccs3 |
| InChI | 1S/C12H9NS/c1-2-9-4-5-11(8-10(9)3-1)12-13-6-7-14-12/h1-2,4-8H,3H2 |
| InChIKey | BVINYGPPSVTBIT-UHFFFAOYSA-N |
| Density | 1.247g/cm3 (Cal.) |
|---|---|
| Boiling point | 349.872°C at 760 mmHg (Cal.) |
| Flash point | 171.9°C (Cal.) |
| Refractive index | 1.661 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(1H-Inden-6-yl)-1,3-thiazole |