Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1-(1H-Inden-6-yl)ethanone |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C11H10O |
| Molecular Weight | 158.20 |
| CAS Registry Number | 92575-92-3 |
| SMILES | CC(=O)C1=CC2=C(C=CC2)C=C1 |
| InChI | 1S/C11H10O/c1-8(12)10-6-5-9-3-2-4-11(9)7-10/h2-3,5-7H,4H2,1H3 |
| InChIKey | ADPFZQUBKWKEAT-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 300.8±31.0°C at 760 mmHg (Cal.) |
| Flash point | 129.2±19.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(1H-Inden-6-yl)ethanone |