|
CAS#: 87090-28-6 Product: Trimethylsulfonium [(phosphonomethyl)amino]acetate No suppilers available for the product. |
| Name | Trimethylsulfonium [(phosphonomethyl)amino]acetate |
|---|---|
| Synonyms | Glycine, N-(phosphonomethyl)-, ion(1-), trimethylsulfonium; Glyphosate mono(trimethylsulfonium) salt; Glyphosate trimethylsulfonium salt |
| Molecular Structure | ![]() |
| Molecular Formula | C6H16NO5PS |
| Molecular Weight | 245.23 |
| CAS Registry Number | 87090-28-6 |
| SMILES | O=C([O-])CNCP(=O)(O)O.[S+](C)(C)C |
| InChI | 1S/C3H8NO5P.C3H9S/c5-3(6)1-4-2-10(7,8)9;1-4(2)3/h4H,1-2H2,(H,5,6)(H2,7,8,9);1-3H3/q;+1/p-1 |
| InChIKey | RUCAXVJJQQJZGU-UHFFFAOYSA-M |
| Boiling point | 465.8°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 235.5°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethylsulfonium [(phosphonomethyl)amino]acetate |