|
CAS#: 87261-28-7 Product: Phenyl(5-phenyl-3-furyl)methanone No suppilers available for the product. |
| Name | Phenyl(5-phenyl-3-furyl)methanone |
|---|---|
| Synonyms | PHENYL(5-PHENYLFURAN-3-YL)METHANONE; NCIOpen2_006424; NSC100239 |
| Molecular Structure | ![]() |
| Molecular Formula | C17H12O2 |
| Molecular Weight | 248.28 |
| CAS Registry Number | 87261-28-7 |
| SMILES | C1=CC=C(C=C1)C2=CC(=CO2)C(=O)C3=CC=CC=C3 |
| InChI | 1S/C17H12O2/c18-17(14-9-5-2-6-10-14)15-11-16(19-12-15)13-7-3-1-4-8-13/h1-12H |
| InChIKey | PNKYTBAITHUYKB-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 408.4±33.0°C at 760 mmHg (Cal.) |
| Flash point | 196.6±18.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Phenyl(5-phenyl-3-furyl)methanone |