Online Database of Chemicals from Around the World
|
CAS#: 87367-19-9 Product: 3-O-Methylcatechin No suppilers available for the product. |
| Name | 3-O-Methylcatechin |
|---|---|
| Synonyms | 2-(3,4-Dihydroxyphenyl)-3-Methoxy-Chroman-5,7-Diol; (2R,3S)-3-Methoxy-3',4',5,7-Flavantetrol; (2R-Trans)-2-(3,4-Dihydroxyphenyl)-3,4-Dihydro-3-Methoxy-2H-1-Benzopyran-5,7-Diol |
| Molecular Structure |  |
| Molecular Formula | C16H16O6 |
| Molecular Weight | 304.30 |
| CAS Registry Number | 87367-19-9 (65350-86-9) |
| SMILES | C3=C(C1C(CC2=C(O1)C=C(O)C=C2O)OC)C=CC(=C3O)O |
| InChI | 1S/C16H16O6/c1-21-15-7-10-12(19)5-9(17)6-14(10)22-16(15)8-2-3-11(18)13(20)4-8/h2-6,15-20H,7H2,1H3 |
| InChIKey | PDHSAQOQVUXZGQ-UHFFFAOYSA-N |
| Density | 1.535g/cm3 (Cal.) |
|---|---|
| Boiling point | 578.517°C at 760 mmHg (Cal.) |
| Flash point | 303.676°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-O-Methylcatechin |