Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | tert-butyl N-(5-amino-2-chloro-phenyl)carbamate |
|---|---|
| Synonyms | CARBAMIC |
| Molecular Structure |  |
| Molecular Formula | C11H15ClN2O2 |
| Molecular Weight | 242.70 |
| CAS Registry Number | 879614-93-4 |
| SMILES | CC(C)(C)OC(=O)Nc1cc(ccc1Cl)N |
| InChI | 1S/C11H15ClN2O2/c1-11(2,3)16-10(15)14-9-6-7(13)4-5-8(9)12/h4-6H,13H2,1-3H3,(H,14,15) |
| InChIKey | FRDRXAUCXAXVHO-UHFFFAOYSA-N |
| Density | 1.26g/cm3 (Cal.) |
|---|---|
| Boiling point | 320.238°C at 760 mmHg (Cal.) |
| Flash point | 147.475°C (Cal.) |
| Refractive index | 1.593 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for tert-butyl N-(5-amino-2-chloro-phenyl)carbamate |