Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-Acetoxy-3-phenylbutanoic acid |
|---|---|
| Synonyms | 4-acetoxy-3-phenylbutanoic acid |
| Molecular Structure |  |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 |
| CAS Registry Number | 881019-77-8 |
| SMILES | OC(=O)CC(COC(C)=O)c1ccccc1 |
| InChI | 1S/C12H14O4/c1-9(13)16-8-11(7-12(14)15)10-5-3-2-4-6-10/h2-6,11H,7-8H2,1H3,(H,14,15) |
| InChIKey | PBWULSBGRZOOSD-UHFFFAOYSA-N |
| Density | 1.188g/cm3 (Cal.) |
|---|---|
| Boiling point | 372.93°C at 760 mmHg (Cal.) |
| Flash point | 142.529°C (Cal.) |
| Refractive index | 1.529 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Acetoxy-3-phenylbutanoic acid |