Online Database of Chemicals from Around the World
| Trylead Chemical Technology Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 (571) 8708-6220 | |||
 |
info@trylead-chem.com | |||
| Chemical manufacturer since 2006 | ||||
| Name | 2-Acetoxy-4-phenylbutanoic acid |
|---|---|
| Synonyms | 2-Acetoxy-4-phenylbutanoic acid; TL80073560 |
| Molecular Structure |  |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 |
| CAS Registry Number | 883723-47-5 |
| SMILES | OC(=O)C(CCc1ccccc1)OC(C)=O |
| InChI | 1S/C12H14O4/c1-9(13)16-11(12(14)15)8-7-10-5-3-2-4-6-10/h2-6,11H,7-8H2,1H3,(H,14,15) |
| InChIKey | IRUYOQOUDJZKEH-UHFFFAOYSA-N |
| Density | 1.19g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.736°C at 760 mmHg (Cal.) |
| Flash point | 144.721°C (Cal.) |
| Refractive index | 1.529 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Acetoxy-4-phenylbutanoic acid |