Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Rieke Metals, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (402) 434-2775 | |||
|
sales@riekemetals.com | |||
| Chemical manufacturer | ||||
| Name | 3-(1,3-Dioxan-2-yl)-1-(4-pentylphenyl)-1-propanone |
|---|---|
| Synonyms | 3-(1,3-Dioxan-2-Yl)-4'-Pentylpropiophenone; MFCD02261819 |
| Molecular Structure |  |
| Molecular Formula | C18H26O3 |
| Molecular Weight | 290.40 |
| CAS Registry Number | 884504-34-1 |
| SMILES | CCCCCc1ccc(cc1)C(=O)CCC2OCCCO2 |
| InChI | 1S/C18H26O3/c1-2-3-4-6-15-7-9-16(10-8-15)17(19)11-12-18-20-13-5-14-21-18/h7-10,18H,2-6,11-14H2,1H3 |
| InChIKey | XNMUWNLUXFLKCA-UHFFFAOYSA-N |
| Density | 1.021g/cm3 (Cal.) |
|---|---|
| Boiling point | 422.974°C at 760 mmHg (Cal.) |
| Flash point | 201.375°C (Cal.) |
| Refractive index | 1.502 (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-(1,3-Dioxan-2-yl)-1-(4-pentylphenyl)-1-propanone |