|
CAS#: 935460-70-1 Product: 1-[3-(1,4-Dioxan-2-yl)phenyl]cyclopropanamine No suppilers available for the product. |
| Name | 1-[3-(1,4-Dioxan-2-yl)phenyl]cyclopropanamine |
|---|---|
| Synonyms | Cyclopropanamine, 1-[3-(1,4-dioxan-2-yl)phenyl]-; Cyclopropanamine,1-[3-(1,4-dioxan-2-yl)phenyl]- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 |
| CAS Registry Number | 935460-70-1 |
| SMILES | c1cc(cc(c1)C2(CC2)N)C3COCCO3 |
| InChI | 1S/C13H17NO2/c14-13(4-5-13)11-3-1-2-10(8-11)12-9-15-6-7-16-12/h1-3,8,12H,4-7,9,14H2 |
| InChIKey | PSMQNLQRQYXXMY-UHFFFAOYSA-N |
| Density | 1.174g/cm3 (Cal.) |
|---|---|
| Boiling point | 344.497°C at 760 mmHg (Cal.) |
| Flash point | 177.835°C (Cal.) |
| Refractive index | 1.573 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[3-(1,4-Dioxan-2-yl)phenyl]cyclopropanamine |