|
CAS#: 885272-32-2 Product: 6-(1-Methyl-1,2,3,6-tetrahydro-4-pyridinyl)-1H-indazole No suppilers available for the product. |
| Name | 6-(1-Methyl-1,2,3,6-tetrahydro-4-pyridinyl)-1H-indazole |
|---|---|
| Synonyms | 6-(1-METHYL-1,2,3,6-TETRAHYDRO-PYRIDIN-4-YL)-1H-INDAZOLE |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15N3 |
| Molecular Weight | 213.28 |
| CAS Registry Number | 885272-32-2 |
| SMILES | CN1CCC(=CC1)C2=CC3=C(C=C2)C=NN3 |
| InChI | 1S/C13H15N3/c1-16-6-4-10(5-7-16)11-2-3-12-9-14-15-13(12)8-11/h2-4,8-9H,5-7H2,1H3,(H,14,15) |
| InChIKey | OBQBTAVZHRCACI-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 401.1±45.0°C at 760 mmHg (Cal.) |
| Flash point | 196.4±28.7°C (Cal.) |
| Refractive index | 1.657 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(1-Methyl-1,2,3,6-tetrahydro-4-pyridinyl)-1H-indazole |