|
CAS#: 885273-31-4 Product: 5-(1-Methyl-1,2,3,6-tetrahydro-4-pyridinyl)-1H-indole No suppilers available for the product. |
| Name | 5-(1-Methyl-1,2,3,6-tetrahydro-4-pyridinyl)-1H-indole |
|---|---|
| Synonyms | 1H-Indole, 5-(1,2,3,6-tetrahydro-1-methyl-4-pyridinyl)-; 5-(1-Methyl-1,2,3,6-tetrahydro-4-pyridinyl)-1H-indol; 5-(1-Methyl-1,2,3,6-tetrahydro-4-pyridinyl)-1H-indole |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.29 |
| CAS Registry Number | 885273-31-4 |
| SMILES | CN1CCC(=CC1)c2ccc3c(c2)cc[nH]3 |
| InChI | 1S/C14H16N2/c1-16-8-5-11(6-9-16)12-2-3-14-13(10-12)4-7-15-14/h2-5,7,10,15H,6,8-9H2,1H3 |
| InChIKey | NLIAPQZSGWHLDK-UHFFFAOYSA-N |
| Density | 1.1±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 391.1±42.0°C at 760 mmHg (Cal.) |
| Flash point | 190.3±27.9°C (Cal.) |
| Refractive index | 1.65 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(1-Methyl-1,2,3,6-tetrahydro-4-pyridinyl)-1H-indole |