Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 5-(2-Furyl)-1H-indazole |
|---|---|
| Synonyms | 1H-Indazole, 5-(2-furanyl)-; 1H-INDAZOLE,5-(2-FURANYL)-; 5-(2-Furyl)-1H-indazol |
| Molecular Structure |  |
| Molecular Formula | C11H8N2O |
| Molecular Weight | 184.19 |
| CAS Registry Number | 885272-43-5 |
| SMILES | c1cc(oc1)c2ccc3c(c2)cn[nH]3 |
| InChI | 1S/C11H8N2O/c1-2-11(14-5-1)8-3-4-10-9(6-8)7-12-13-10/h1-7H,(H,12,13) |
| InChIKey | LAMFLSORFDHFFB-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.0±17.0°C at 760 mmHg (Cal.) |
| Flash point | 194.9±14.9°C (Cal.) |
| Refractive index | 1.67 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(2-Furyl)-1H-indazole |