Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 6-(2-Furyl)-1H-indole |
|---|---|
| Synonyms | 1H-Indole, 6-(2-furanyl)-; 1H-INDOLE,6-(2-FURANYL)-; 6-(2-Furyl)-1H-indol |
| Molecular Structure |  |
| Molecular Formula | C12H9NO |
| Molecular Weight | 183.21 |
| CAS Registry Number | 885273-35-8 |
| SMILES | c1cc(oc1)c2ccc3cc[nH]c3c2 |
| InChI | 1S/C12H9NO/c1-2-12(14-7-1)10-4-3-9-5-6-13-11(9)8-10/h1-8,13H |
| InChIKey | LKOMEJBHZIMBLT-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.7±17.0°C at 760 mmHg (Cal.) |
| Flash point | 183.0±14.9°C (Cal.) |
| Refractive index | 1.661 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(2-Furyl)-1H-indole |