|
CAS#: 885272-48-0 Product: 5-(1-Benzothiophen-2-yl)-1H-indazole No suppilers available for the product. |
| Name | 5-(1-Benzothiophen-2-yl)-1H-indazole |
|---|---|
| Synonyms | 1H-Indazole, 5-benzo[b]thien-2-yl-; 1H-INDAZOLE,5-BENZO[B]THIEN-2-YL-; 5-(1-Benzothiophen-2-yl)-1H-indazol |
| Molecular Structure | ![]() |
| Molecular Formula | C15H10N2S |
| Molecular Weight | 250.32 |
| CAS Registry Number | 885272-48-0 |
| SMILES | c1ccc2c(c1)cc(s2)c3ccc4c(c3)cn[nH]4 |
| InChI | 1S/C15H10N2S/c1-2-4-14-10(3-1)8-15(18-14)11-5-6-13-12(7-11)9-16-17-13/h1-9H,(H,16,17) |
| InChIKey | ZVLIUJUEWWITKD-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 505.6±25.0°C at 760 mmHg (Cal.) |
| Flash point | 255.1±13.5°C (Cal.) |
| Refractive index | 1.783 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(1-Benzothiophen-2-yl)-1H-indazole |