|
CAS#: 885273-41-6 Product: 6-(1-Benzothiophen-2-yl)-1H-indole No suppilers available for the product. |
| Name | 6-(1-Benzothiophen-2-yl)-1H-indole |
|---|---|
| Synonyms | 1H-Indole, 6-benzo[b]thien-2-yl-; 1H-INDOLE,6-BENZO[B]THIEN-2-YL-; 6-(1-Benzothiophen-2-yl)-1H-indol |
| Molecular Structure | ![]() |
| Molecular Formula | C16H11NS |
| Molecular Weight | 249.33 |
| CAS Registry Number | 885273-41-6 |
| SMILES | c1ccc2c(c1)cc(s2)c3ccc4cc[nH]c4c3 |
| InChI | 1S/C16H11NS/c1-2-4-15-12(3-1)10-16(18-15)13-6-5-11-7-8-17-14(11)9-13/h1-10,17H |
| InChIKey | RAXZRLLHTSSBKZ-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 492.2±20.0°C at 760 mmHg (Cal.) |
| Flash point | 245.4±12.2°C (Cal.) |
| Refractive index | 1.771 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 6-(1-Benzothiophen-2-yl)-1H-indole |