|
CAS#: 885277-69-0 Product: 4-Chloro-2-(4-chlorophenyl)-6-methylquinazoline No suppilers available for the product. |
| Name | 4-Chloro-2-(4-chlorophenyl)-6-methylquinazoline |
|---|---|
| Synonyms | 4-Chlor-2-(4-chlorphenyl)-6-methylchinazolin; 4-Chloro-2-(4-chlorophenyl)-6-methylquinazoline; 4-CHLORO-2-(4-CHLORO-PHENYL)-6-METHYL-QUINAZOLINE |
| Molecular Structure | ![]() |
| Molecular Formula | C15H10Cl2N2 |
| Molecular Weight | 289.16 |
| CAS Registry Number | 885277-69-0 |
| SMILES | Cc1ccc2c(c1)c(nc(n2)c3ccc(cc3)Cl)Cl |
| InChI | 1S/C15H10Cl2N2/c1-9-2-7-13-12(8-9)14(17)19-15(18-13)10-3-5-11(16)6-4-10/h2-8H,1H3 |
| InChIKey | FQAGOXLBNSMBFS-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 295.3±32.0°C at 760 mmHg (Cal.) |
| Flash point | 160.4±10.7°C (Cal.) |
| Refractive index | 1.659 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-2-(4-chlorophenyl)-6-methylquinazoline |