Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 4-Chloro-2-(4-chlorophenyl)-5-methylquinazoline |
|---|---|
| Synonyms | 4-Chlor-2-(4-chlorphenyl)-5-methylchinazolin; 4-Chloro-2-(4-chlorophenyl)-5-methylquinazoline; 4-CHLORO-2-(4-CHLORO-PHENYL)-5-METHYL-QUINAZOLINE |
| Molecular Structure |  |
| Molecular Formula | C15H10Cl2N2 |
| Molecular Weight | 289.16 |
| CAS Registry Number | 885277-78-1 |
| SMILES | Cc1cccc2c1c(nc(n2)c3ccc(cc3)Cl)Cl |
| InChI | 1S/C15H10Cl2N2/c1-9-3-2-4-12-13(9)14(17)19-15(18-12)10-5-7-11(16)8-6-10/h2-8H,1H3 |
| InChIKey | JLRUACUTKLKJFI-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 290.0±32.0°C at 760 mmHg (Cal.) |
| Flash point | 156.8±10.7°C (Cal.) |
| Refractive index | 1.659 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Chloro-2-(4-chlorophenyl)-5-methylquinazoline |