| AOBChem USA | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (323) 382-7678 | |||
![]() |
sales@aobchem.com | |||
| Chemical manufacturer | ||||
| Alfa Aesar. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (978) 521-6300 | |||
![]() |
info@alfa.com | |||
| Chemical manufacturer | ||||
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BoroChem | France | Inquire | ||
|---|---|---|---|---|
![]() |
+33 (2) 3194-5073 | |||
![]() |
info@borochem.fr | |||
| Chemical manufacturer | ||||
| Name | 4-[4-(Benzyloxy)-5-bromo-2-pyrimidinyl]morpholine |
|---|---|
| Synonyms | [885952-23-8]; 4-(4-Benzyloxy-5-bromo-2-pyrimidinyl)morpholine; 4-(4-BENZYLOXY-5-BROMOPYRIMIDIN-2-YL)MORPHOLINE |
| Molecular Structure | ![]() |
| Molecular Formula | C15H16BrN3O2 |
| Molecular Weight | 350.21 |
| CAS Registry Number | 885952-23-8 |
| SMILES | C1COCCN1C2=NC=C(C(=N2)OCC3=CC=CC=C3)Br |
| InChI | 1S/C15H16BrN3O2/c16-13-10-17-15(19-6-8-20-9-7-19)18-14(13)21-11-12-4-2-1-3-5-12/h1-5,10H,6-9,11H2 |
| InChIKey | DMIIRAXOFYSJQT-UHFFFAOYSA-N |
| Density | 1.398-1.518 (Expl.) |
|---|---|
| 1.5±0.1g/cm3 (Cal.) | |
| Melting point | 114-116°C (Expl.) |
| Boiling point | 507.5±60.0°C at 760 mmHg (Cal.) |
| Flash point | 260.7±32.9°C (Cal.) |
| Refractive index | 1.609 (Cal.) |
| Safety Description | CAUTION: May irritate eyes, skin, and respiratory tract |
|---|---|
| SDS | Available |
| Market Analysis Reports |
| List of Reports Available for 4-[4-(Benzyloxy)-5-bromo-2-pyrimidinyl]morpholine |