Online Database of Chemicals from Around the World
|
CAS#: 906453-92-7 Product: (3R)-3-(Benzyloxy)butanamide No suppilers available for the product. |
| Name | (3R)-3-(Benzyloxy)butanamide |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.24 |
| CAS Registry Number | 906453-92-7 |
| SMILES | O=C(N)C[C@H](OCc1ccccc1)C |
| InChI | 1S/C11H15NO2/c1-9(7-11(12)13)14-8-10-5-3-2-4-6-10/h2-6,9H,7-8H2,1H3,(H2,12,13)/t9-/m1/s1 |
| InChIKey | DBDRITVINRHBEW-SECBINFHSA-N |
| Density | 1.078g/cm3 (Cal.) |
|---|---|
| Boiling point | 358.414°C at 760 mmHg (Cal.) |
| Flash point | 177.468°C (Cal.) |
| Refractive index | 1.525 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3R)-3-(Benzyloxy)butanamide |