Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Beta Pharma Scientific, Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (203) 315-5062 / (877) 786-1922 | |||
|
sales@betapharma.com, | |||
| Chemical manufacturer | ||||
| Name | 1-{3-[4-(2-Methyl-2-propanyl)phenoxy]phenyl}methanamine |
|---|---|
| Synonyms | 1-{3-[4-(2-Methyl-2-propanyl)phenoxy]phenyl}methanamin; 1-{3-[4-(2-Methyl-2-propanyl)phenoxy]phenyl}methanamine; 1-{3-[4-(2-Méthyl-2-propanyl)phénoxy]phényl}méthanamine |
| Molecular Structure | ![CAS#: 887582-95-8， 1-{3-[4-(2-Methyl-2-propanyl)phenoxy]phenyl}methanamine](/moreStructures/887582-95-8.gif) |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.35 |
| CAS Registry Number | 887582-95-8 |
| SMILES | CC(C)(C)c1ccc(cc1)Oc2cccc(c2)CN |
| InChI | 1S/C17H21NO/c1-17(2,3)14-7-9-15(10-8-14)19-16-6-4-5-13(11-16)12-18/h4-11H,12,18H2,1-3H3 |
| InChIKey | KQNSPSCVNXCGHK-UHFFFAOYSA-N |
| Density | 1.0±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.7±30.0°C at 760 mmHg (Cal.) |
| Flash point | 166.8±17.8°C (Cal.) |
| Refractive index | 1.558 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-{3-[4-(2-Methyl-2-propanyl)phenoxy]phenyl}methanamine |