Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
|
+380 (44) 522-2458 | |||
|
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 2-[4-(2-Methyl-2-Propanyl)Phenyl]Butanoic Acid |
|---|---|
| Synonyms | 2-(4-(tert-butyl)phenyl)butanoic acid |
| Molecular Structure | ![CAS#: 211314-96-4， 2-[4-(2-Methyl-2-Propanyl)Phenyl]Butanoic Acid](/moreStructures/211314-96-4.gif) |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.31 |
| CAS Registry Number | 211314-96-4 |
| SMILES | O=C(O)C(c1ccc(cc1)C(C)(C)C)CC |
| InChI | 1S/C14H20O2/c1-5-12(13(15)16)10-6-8-11(9-7-10)14(2,3)4/h6-9,12H,5H2,1-4H3,(H,15,16) |
| InChIKey | XRDNTERBDNLRHD-UHFFFAOYSA-N |
| Density | 1.014g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.513°C at 760 mmHg (Cal.) |
| Flash point | 224.548°C (Cal.) |
| Refractive index | 1.51 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[4-(2-Methyl-2-Propanyl)Phenyl]Butanoic Acid |