Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | 1-(3,4-Dimethoxybenzyl)-3-piperidinecarboxylic acid |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.33 |
| CAS Registry Number | 896046-80-3 |
| SMILES | O=C(O)C2CN(Cc1cc(OC)c(OC)cc1)CCC2 |
| InChI | 1S/C15H21NO4/c1-19-13-6-5-11(8-14(13)20-2)9-16-7-3-4-12(10-16)15(17)18/h5-6,8,12H,3-4,7,9-10H2,1-2H3,(H,17,18) |
| InChIKey | MSNNPZAQBNVZLL-UHFFFAOYSA-N |
| Density | 1.183g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.831°C at 760 mmHg (Cal.) |
| Flash point | 208.312°C (Cal.) |
| Refractive index | 1.55 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(3,4-Dimethoxybenzyl)-3-piperidinecarboxylic acid |