Online Database of Chemicals from Around the World

5-Hydroxynicotinic acid methyl ester hydrochloride
[CAS# 89937-78-0]

List of Suppliers
Shijiazhuang C-element Biotech Co., Ltd. China Inquire
www.c-elementbiotech.com
+86 18033710157
Lisa@C-elementBiotech.com
QQ Chat
WeChat: 18033710157
Chemical manufacturer since 2025
chemBlink Standard supplier since 2025
A Chemtek USA Inquire
www.achemtek.com
+1 (508) 471-4121
263-9441
+1 (508) 845-9201
sales@achemtek.com
Chemical manufacturer
Accel Pharmtech, LLC USA Inquire
www.accelpharmtech.com
+1 (732) 993-9004
+1 (732) 289-6244
info@accelpharmtech.com
Chemical manufacturer

Identification
ClassificationOrganic raw materials >> Carboxylic compounds and derivatives >> Salt of carboxylic acid ester and its derivatives
Name5-Hydroxynicotinic acid methyl ester hydrochloride
Molecular StructureCAS # 89937-78-0, 5-Hydroxynicotinic acid methyl ester hydrochloride
Molecular FormulaC7H7NO3.HCl
Molecular Weight189.60
CAS Registry Number89937-78-0
SMILESCOC(=O)C1=CC(=CN=C1)O.Cl
Safety Data
Hazard Symbolssymbol   GHS07 Warning  Details
Risk StatementsH302-H315-H319  Details
Safety StatementsP261-P305+P351+P338  Details
SDSAvailable
up Discovery and Applications
5-Hydroxynicotinic acid methyl ester hydrochloride, with the chemical formula C7H8ClNO3, is a derivative of 5-hydroxynicotinic acid, where the carboxylic acid group is esterified with methanol, and the compound is in its hydrochloride salt form. This compound is part of the class of nicotinic acid derivatives, which are of interest in various fields due to their biological activities and synthetic applications.

The discovery of 5-hydroxynicotinic acid methyl ester hydrochloride can be traced to the broader exploration of nicotinic acid derivatives, which have been studied for their potential in pharmaceuticals, specifically for their effects on metabolism and their role in biochemical processes. While the specific historical details of the synthesis of 5-hydroxynicotinic acid methyl ester hydrochloride are less documented, its synthetic pathway is an extension of established methods for modifying nicotinic acid derivatives, such as esterification and halogenation.

This compound is primarily used in the synthesis of various biologically active molecules and intermediates in pharmaceutical and chemical industries. As a methyl ester of 5-hydroxynicotinic acid, it retains the functional groups characteristic of nicotinic acid, making it a useful intermediate for further chemical transformations, such as the preparation of more complex molecules. It is particularly useful for modifying bioactive molecules in medicinal chemistry, where functional group alterations can lead to enhanced activity or selectivity.

In the pharmaceutical industry, nicotinic acid derivatives, including 5-hydroxynicotinic acid methyl ester hydrochloride, have attracted attention for their potential effects on the nervous system, metabolism, and cardiovascular health. These compounds are often investigated for their ability to influence nicotinic receptors, which play a role in neurotransmission, and for their effects on lipid metabolism, as they are structurally related to nicotinic acid (niacin), a well-known drug used to manage cholesterol levels.

Additionally, 5-hydroxynicotinic acid methyl ester hydrochloride may be used in the preparation of various functionalized compounds through chemical reactions, such as nucleophilic substitutions or further esterifications, which can lead to compounds with enhanced pharmacological properties. It serves as a versatile intermediate in synthetic organic chemistry, enabling the construction of more complex structures relevant to drug discovery.

The compound's role extends beyond pharmaceuticals to potential applications in the synthesis of agrochemicals, where nicotinic acid derivatives are sometimes employed to develop new pesticides or plant growth regulators. Its structural features allow it to be explored for various chemical modifications, contributing to the development of novel molecules in multiple sectors.

Despite its utility in chemical synthesis and pharmaceutical applications, 5-hydroxynicotinic acid methyl ester hydrochloride, like other derivatives of nicotinic acid, must be handled with care. The toxicity and safety of compounds containing nicotinic acid derivatives are important considerations, particularly in high concentrations or in prolonged exposure scenarios. Therefore, handling and usage are regulated to minimize health risks, particularly in industrial or laboratory environments.

In conclusion, 5-hydroxynicotinic acid methyl ester hydrochloride is an important chemical compound with applications in the pharmaceutical and chemical industries. It serves as a key intermediate in the synthesis of biologically active molecules, with potential applications in drug development, particularly for cardiovascular and neurological conditions. Its role in organic synthesis and potential in drug discovery make it a valuable compound in various research and industrial settings, though its use requires appropriate safety measures due to its chemical properties.

References

none
Market Analysis Reports
List of Reports Available for 5-Hydroxynicotinic acid methyl ester hydrochloride
Related Products
3-Hydroxy Nevir...  2-Hydroxy Nevir...  6-Hydroxy Nicor...  2-Hydroxynicoti...  6-Hydroxynicoti...  5-Hydroxynicoti...  6-Hydroxynicoti...  4-Hydroxynicoti...  2-Hydroxynicoti...  4-Hydroxy-Nicot...  2-Hydroxynicoti...  6-Hydroxynicoti...  5-Hydroxynicoti...  5-Hydroxynicoti...  4-Hydroxynicoti...  6-Hydroxynicoti...  6-Hydroxynicoti...  6alpha-Hydroxyn...  4-Hydroxynipeco...  5-Hydroxynirida...